C24H27NO3 — CID 19975606
ethyl 3-[6-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate (PubChem CID 19975606) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is ethyl 3-[6-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate.
| Compound Name | ethyl 3-[6-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 19975606 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 3-[6-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C#Cc2cc3c(cc2C)OCCC3(C)C)nc1 |
| InChI | InChI=1S/C24H27NO3/c1-5-27-23(26)11-7-18-6-9-20(25-16-18)10-8-19-15-21-22(14-17(19)2)28-13-12-24(21,3)4/h6,9,14-16H,5,7,11-13H2,1-4H3 |
| InChIKey | OYBDTKUXCLIZSE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|