C31H41NO3 — CID 18322041
ethyl 3-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate (PubChem CID 18322041) has the molecular formula C31H41NO3 and a molecular weight of 475.67 g/mol. Its IUPAC name is ethyl 3-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate.
| Compound Name | ethyl 3-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 18322041 |
| Molecular Formula | C31H41NO3 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | ethyl 3-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]-3-pyridinyl]propanoate |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(CCC(=O)OCC)cn1)C(CC)(CC)CCO2 |
| InChI | InChI=1S/C31H41NO3/c1-5-9-10-11-12-25-22-29-28(31(6-2,7-3)19-20-35-29)21-26(25)15-17-27-16-13-24(23-32-27)14-18-30(33)34-8-4/h13,16,21-23H,5-12,14,18-20H2,1-4H3 |
| InChIKey | KRCUBAYOTZUSRC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|