About [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate
[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate (PubChem CID 23222752) has the molecular formula C29H38N2O3
and a molecular weight of 462.63 g/mol. Its IUPAC name is [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate.
Molecular Properties
| Compound Name | [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate |
| PubChem CID | 23222752 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(OC(=O)CCC)nn1)C(CC)(CC)CCO2 |
| InChI | InChI=1S/C29H38N2O3/c1-5-9-10-11-13-22-21-26-25(29(7-3,8-4)18-19-33-26)20-23(22)14-15-24-16-17-27(31-30-24)34-28(32)12-6-2/h16-17,20-21H,5-13,18-19H2,1-4H3 |
| InChIKey | ONJMXTNXLVUIAG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate?
The IUPAC name of [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate (CID 23222752) is [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate.
What is the SMILES notation for [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate?
The canonical SMILES for [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate is CCCCCCc1cc2c(cc1C#Cc1ccc(OC(=O)CCC)nn1)C(CC)(CC)CCO2.
What is the InChIKey of [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate?
The InChIKey is ONJMXTNXLVUIAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H38N2O3/c1-5-9-10-11-13-22-21-26-25(29(7-3,8-4)18-19-33-26)20-23(22)14-15-24-16-17-27(31-30-24)34-28(32)12-6-2/h16-17,20-21H,5-13,18-19H2,1-4H3.
What are the key properties of [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate?
[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate has a molecular weight of 462.63 g/mol, XLogP of 6.55, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrochromen-6-yl)ethynyl]pyridazin-3-yl] butanoate is sourced from PubChem (CID 23222752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).