C24H26O3 — CID 18321999
2-[4-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]phenyl]acetic acid (PubChem CID 18321999) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[4-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 18321999 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[4-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]phenyl]acetic acid |
| SMILES | CCC1(CC)CCOc2cc(C)c(C#Cc3ccc(CC(=O)O)cc3)cc21 |
| InChI | InChI=1S/C24H26O3/c1-4-24(5-2)12-13-27-22-14-17(3)20(16-21(22)24)11-10-18-6-8-19(9-7-18)15-23(25)26/h6-9,14,16H,4-5,12-13,15H2,1-3H3,(H,25,26) |
| InChIKey | IBBPAVBOZSVOAA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|