C22H24O4 — CID 18947738
ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]furan-2-yl]acetate (PubChem CID 18947738) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]furan-2-yl]acetate.
| Compound Name | ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]furan-2-yl]acetate |
|---|---|
| PubChem CID | 18947738 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)ethynyl]furan-2-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C#Cc2cc3c(cc2C)OCCC3(C)C)o1 |
| InChI | InChI=1S/C22H24O4/c1-5-24-21(23)14-18-9-8-17(26-18)7-6-16-13-19-20(12-15(16)2)25-11-10-22(19,3)4/h8-9,12-13H,5,10-11,14H2,1-4H3 |
| InChIKey | VLYAETLHAPTEGL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|