C29H38O4S — CID 57230445
ethyl 2-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]acetate (PubChem CID 57230445) has the molecular formula C29H38O4S and a molecular weight of 482.69 g/mol. Its IUPAC name is ethyl 2-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]acetate.
| Compound Name | ethyl 2-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]acetate |
|---|---|
| PubChem CID | 57230445 |
| Molecular Formula | C29H38O4S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | ethyl 2-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]acetate |
| SMILES | CCCCCCSc1cc2c(cc1C#Cc1ccc(CC(=O)OCC)o1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C29H38O4S/c1-7-9-10-11-16-34-26-19-25-24(28(3,4)20-29(5,6)33-25)17-21(26)12-13-22-14-15-23(32-22)18-27(30)31-8-2/h14-15,17,19H,7-11,16,18,20H2,1-6H3 |
| InChIKey | XNJSUPGMGZOYFD-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|