C25H32N2OS — CID 57086836
5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidine (PubChem CID 57086836) has the molecular formula C25H32N2OS and a molecular weight of 408.61 g/mol. Its IUPAC name is 5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidine.
| Compound Name | 5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidine |
|---|---|
| PubChem CID | 57086836 |
| Molecular Formula | C25H32N2OS |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidine |
| SMILES | CCCCCCSc1cc2c(cc1C#Cc1cncnc1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C25H32N2OS/c1-6-7-8-9-12-29-23-14-22-21(24(2,3)17-25(4,5)28-22)13-20(23)11-10-19-15-26-18-27-16-19/h13-16,18H,6-9,12,17H2,1-5H3 |
| InChIKey | MCTQRZSGVYSFLH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|