C21H34O2 — CID 15332912
2,2,4,4-tetramethyl-7-octyl-3H-chromen-6-ol (PubChem CID 15332912) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-7-octyl-3H-chromen-6-ol.
| Compound Name | 2,2,4,4-tetramethyl-7-octyl-3H-chromen-6-ol |
|---|---|
| PubChem CID | 15332912 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 2,2,4,4-tetramethyl-7-octyl-3H-chromen-6-ol |
| SMILES | CCCCCCCCc1cc2c(cc1O)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C21H34O2/c1-6-7-8-9-10-11-12-16-13-19-17(14-18(16)22)20(2,3)15-21(4,5)23-19/h13-14,22H,6-12,15H2,1-5H3 |
| InChIKey | UZVBAWBPIHEJKV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|