C27H34N2O2S — CID 22903931
2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridazin-3-yl]acetic acid (PubChem CID 22903931) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is 2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridazin-3-yl]acetic acid.
| Compound Name | 2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridazin-3-yl]acetic acid |
|---|---|
| PubChem CID | 22903931 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyridazin-3-yl]acetic acid |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(CC(=O)O)nn1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C27H34N2O2S/c1-6-7-8-9-10-19-16-24-23(26(2,3)18-27(4,5)32-24)15-20(19)11-12-21-13-14-22(29-28-21)17-25(30)31/h13-16H,6-10,17-18H2,1-5H3,(H,30,31) |
| InChIKey | OCMUQZLZKAOXDT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|