C25H30N2O2S — CID 67712003
ethyl 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate (PubChem CID 67712003) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is ethyl 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
|---|---|
| PubChem CID | 67712003 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | ethyl 2-[5-[2-(7-ethyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cnc(C#Cc2cc3c(cc2CC)SC(C)(C)CC3(C)C)cn1 |
| InChI | InChI=1S/C25H30N2O2S/c1-7-17-12-22-21(24(3,4)16-25(5,6)30-22)11-18(17)9-10-19-14-27-20(15-26-19)13-23(28)29-8-2/h11-12,14-15H,7-8,13,16H2,1-6H3 |
| InChIKey | QUFJUYHFPQXSCR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|