C24H26O2S — CID 54312890
ethyl 4-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]benzoate (PubChem CID 54312890) has the molecular formula C24H26O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is ethyl 4-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 54312890 |
| Molecular Formula | C24H26O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 4-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)SC(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C24H26O2S/c1-6-26-22(25)19-12-9-17(10-13-19)7-8-18-11-14-20-21(15-18)27-24(4,5)16-23(20,2)3/h9-15H,6,16H2,1-5H3 |
| InChIKey | SMDFFNWNHQSJKS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|