C25H26O2S — CID 19962321
ethyl 4-[2-(5-ethylsulfanyl-8,8-dimethyl-7H-naphthalen-2-yl)ethynyl]benzoate (PubChem CID 19962321) has the molecular formula C25H26O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is ethyl 4-[2-(5-ethylsulfanyl-8,8-dimethyl-7H-naphthalen-2-yl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(5-ethylsulfanyl-8,8-dimethyl-7H-naphthalen-2-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 19962321 |
| Molecular Formula | C25H26O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl 4-[2-(5-ethylsulfanyl-8,8-dimethyl-7H-naphthalen-2-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CC=C3SCC)cc1 |
| InChI | InChI=1S/C25H26O2S/c1-5-27-24(26)20-12-9-18(10-13-20)7-8-19-11-14-21-22(17-19)25(3,4)16-15-23(21)28-6-2/h9-15,17H,5-6,16H2,1-4H3 |
| InChIKey | IMKDXBVEVLNHNC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|