C35H40O3Si — CID 22323730
ethyl 4-[2-[8-[3-[dimethyl(2-methylpropyl)silyl]oxyphenyl]-5,5-dimethyl-6H-naphthalen-2-yl]ethynyl]benzoate (PubChem CID 22323730) has the molecular formula C35H40O3Si and a molecular weight of 536.79 g/mol. Its IUPAC name is ethyl 4-[2-[8-[3-[dimethyl(2-methylpropyl)silyl]oxyphenyl]-5,5-dimethyl-6H-naphthalen-2-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[8-[3-[dimethyl(2-methylpropyl)silyl]oxyphenyl]-5,5-dimethyl-6H-naphthalen-2-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 22323730 |
| Molecular Formula | C35H40O3Si |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | ethyl 4-[2-[8-[3-[dimethyl(2-methylpropyl)silyl]oxyphenyl]-5,5-dimethyl-6H-naphthalen-2-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(c2cccc(O[Si](C)(C)CC(C)C)c2)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C35H40O3Si/c1-8-37-34(36)28-17-14-26(15-18-28)12-13-27-16-19-33-32(22-27)31(20-21-35(33,4)5)29-10-9-11-30(23-29)38-39(6,7)24-25(2)3/h9-11,14-20,22-23,25H,8,21,24H2,1-7H3 |
| InChIKey | SOBXZAILVYRVLF-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|