C33H35NO2 — CID 10050733
4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-(2-methylpropyl)benzamide (PubChem CID 10050733) has the molecular formula C33H35NO2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 10050733 |
| Molecular Formula | C33H35NO2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-(2-methylpropyl)benzamide |
| SMILES | Cc1ccc(C2=CCC(C)(C)c3cc(C(O)C#Cc4ccc(C(=O)NCC(C)C)cc4)ccc32)cc1 |
| InChI | InChI=1S/C33H35NO2/c1-22(2)21-34-32(36)26-13-8-24(9-14-26)10-17-31(35)27-15-16-29-28(25-11-6-23(3)7-12-25)18-19-33(4,5)30(29)20-27/h6-9,11-16,18,20,22,31,35H,19,21H2,1-5H3,(H,34,36) |
| InChIKey | HDLBYSUXDULMBO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|