C18H22NO3P — CID 138023195
4-dimethylphosphoryl-N-[(2R)-2-hydroxy-2-(4-methylphenyl)ethyl]benzamide (PubChem CID 138023195) has the molecular formula C18H22NO3P and a molecular weight of 331.35 g/mol. Its IUPAC name is 4-dimethylphosphoryl-N-[(2R)-2-hydroxy-2-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 4-dimethylphosphoryl-N-[(2R)-2-hydroxy-2-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 138023195 |
| Molecular Formula | C18H22NO3P |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-dimethylphosphoryl-N-[(2R)-2-hydroxy-2-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc([C@@H](O)CNC(=O)c2ccc(P(C)(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H22NO3P/c1-13-4-6-14(7-5-13)17(20)12-19-18(21)15-8-10-16(11-9-15)23(2,3)22/h4-11,17,20H,12H2,1-3H3,(H,19,21)/t17-/m0/s1 |
| InChIKey | GXGALKBRNKJXGH-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|