C24H26N2O4S — CID 112827264
2-N,5-N-bis[2-hydroxy-2-(4-methylphenyl)ethyl]thiophene-2,5-dicarboxamide (PubChem CID 112827264) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-N,5-N-bis[2-hydroxy-2-(4-methylphenyl)ethyl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[2-hydroxy-2-(4-methylphenyl)ethyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 112827264 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-N,5-N-bis[2-hydroxy-2-(4-methylphenyl)ethyl]thiophene-2,5-dicarboxamide |
| SMILES | Cc1ccc(C(O)CNC(=O)c2ccc(C(=O)NCC(O)c3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-15-3-7-17(8-4-15)19(27)13-25-23(29)21-11-12-22(31-21)24(30)26-14-20(28)18-9-5-16(2)6-10-18/h3-12,19-20,27-28H,13-14H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | VDOQNXRGPSYUIO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |