C31H30O6 — CID 10074632
4-[3-[5-[4-(ethoxymethoxy)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-3-hydroxybenzoic acid (PubChem CID 10074632) has the molecular formula C31H30O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-[3-[5-[4-(ethoxymethoxy)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-3-hydroxybenzoic acid.
| Compound Name | 4-[3-[5-[4-(ethoxymethoxy)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 10074632 |
| Molecular Formula | C31H30O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 4-[3-[5-[4-(ethoxymethoxy)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]-3-hydroxyprop-1-ynyl]-3-hydroxybenzoic acid |
| SMILES | CCOCOc1ccc(C2=CCC(C)(C)c3cc(C(O)C#Cc4ccc(C(=O)O)cc4O)ccc32)cc1 |
| InChI | InChI=1S/C31H30O6/c1-4-36-19-37-24-11-7-20(8-12-24)25-15-16-31(2,3)27-17-22(9-13-26(25)27)28(32)14-10-21-5-6-23(30(34)35)18-29(21)33/h5-9,11-13,15,17-18,28,32-33H,4,16,19H2,1-3H3,(H,34,35) |
| InChIKey | UXFCIYVYKRUJIW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|