C29H27NO2 — CID 22323753
ethyl 4-[2-[5,5-dimethyl-8-(6-methyl-3-pyridinyl)-6H-naphthalen-2-yl]ethynyl]benzoate (PubChem CID 22323753) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl 4-[2-[5,5-dimethyl-8-(6-methyl-3-pyridinyl)-6H-naphthalen-2-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[5,5-dimethyl-8-(6-methyl-3-pyridinyl)-6H-naphthalen-2-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 22323753 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethyl 4-[2-[5,5-dimethyl-8-(6-methyl-3-pyridinyl)-6H-naphthalen-2-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(c2ccc(C)nc2)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C29H27NO2/c1-5-32-28(31)23-13-9-21(10-14-23)7-8-22-11-15-27-26(18-22)25(16-17-29(27,3)4)24-12-6-20(2)30-19-24/h6,9-16,18-19H,5,17H2,1-4H3 |
| InChIKey | WTRPVDAFEIWXJA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|