C29H29NO2 — CID 18931456
ethyl 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethynyl]benzoate (PubChem CID 18931456) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is ethyl 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 18931456 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | ethyl 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)N(c2ccc(C)cc2)CCC3(C)C)cc1 |
| InChI | InChI=1S/C29H29NO2/c1-5-32-28(31)24-13-10-22(11-14-24)8-9-23-12-17-26-27(20-23)30(19-18-29(26,3)4)25-15-6-21(2)7-16-25/h6-7,10-17,20H,5,18-19H2,1-4H3 |
| InChIKey | BHPUUGXMBAPWPZ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|