C25H24O4 — CID 19962328
ethyl 4-[2-(8-acetyloxy-5,5-dimethyl-6H-naphthalen-2-yl)ethynyl]benzoate (PubChem CID 19962328) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is ethyl 4-[2-(8-acetyloxy-5,5-dimethyl-6H-naphthalen-2-yl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(8-acetyloxy-5,5-dimethyl-6H-naphthalen-2-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 19962328 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | ethyl 4-[2-(8-acetyloxy-5,5-dimethyl-6H-naphthalen-2-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(OC(C)=O)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C25H24O4/c1-5-28-24(27)20-11-8-18(9-12-20)6-7-19-10-13-22-21(16-19)23(29-17(2)26)14-15-25(22,3)4/h8-14,16H,5,15H2,1-4H3 |
| InChIKey | PNEJFYCTHWCWOW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|