C36H40O2 — CID 59073970
octyl 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate (PubChem CID 59073970) has the molecular formula C36H40O2 and a molecular weight of 504.71 g/mol. Its IUPAC name is octyl 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate.
| Compound Name | octyl 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 59073970 |
| Molecular Formula | C36H40O2 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | octyl 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoate |
| SMILES | CCCCCCCCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(c2ccc(C)cc2)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C36H40O2/c1-5-6-7-8-9-10-25-38-35(37)31-20-15-28(16-21-31)13-14-29-17-22-34-33(26-29)32(23-24-36(34,3)4)30-18-11-27(2)12-19-30/h11-12,15-23,26H,5-10,24-25H2,1-4H3 |
| InChIKey | MPRHSDDLYMRBMW-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|