C25H28O2Se — CID 15411447
ethyl 4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoate (PubChem CID 15411447) has the molecular formula C25H28O2Se and a molecular weight of 439.46 g/mol. Its IUPAC name is ethyl 4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 15411447 |
| Molecular Formula | C25H28O2Se |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | ethyl 4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#C[Se]c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C25H28O2Se/c1-6-27-23(26)19-9-7-18(8-10-19)13-16-28-20-11-12-21-22(17-20)25(4,5)15-14-24(21,2)3/h7-12,17H,6,14-15H2,1-5H3 |
| InChIKey | NJXRGNMCEJSLLB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|