C25H29NO2Se — CID 10217042
ethyl 6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)selanyl]ethynyl]pyridine-3-carboxylate (PubChem CID 10217042) has the molecular formula C25H29NO2Se and a molecular weight of 454.47 g/mol. Its IUPAC name is ethyl 6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)selanyl]ethynyl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)selanyl]ethynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10217042 |
| Molecular Formula | C25H29NO2Se |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | ethyl 6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)selanyl]ethynyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C#C[Se]c2cc(C)cc3c2C(C)(C)CCC3(C)C)nc1 |
| InChI | InChI=1S/C25H29NO2Se/c1-7-28-23(27)18-8-9-19(26-16-18)10-13-29-21-15-17(2)14-20-22(21)25(5,6)12-11-24(20,3)4/h8-9,14-16H,7,11-12H2,1-6H3 |
| InChIKey | IPERSXXSBZLIEW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|