C29H30N2O2Se — CID 22641108
N-(4-hydroxyphenyl)-6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxamide (PubChem CID 22641108) has the molecular formula C29H30N2O2Se and a molecular weight of 517.53 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22641108 |
| Molecular Formula | C29H30N2O2Se |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-6-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxamide |
| SMILES | Cc1cc2c(cc1[Se]C#Cc1ccc(C(=O)Nc3ccc(O)cc3)cn1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H30N2O2Se/c1-19-16-24-25(29(4,5)14-13-28(24,2)3)17-26(19)34-15-12-21-7-6-20(18-30-21)27(33)31-22-8-10-23(32)11-9-22/h6-11,16-18,32H,13-14H2,1-5H3,(H,31,33) |
| InChIKey | OFQCEFAPYGULFN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|