C31H35NO — CID 90348625
N-(3-methylphenyl)-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide (PubChem CID 90348625) has the molecular formula C31H35NO and a molecular weight of 437.63 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide.
| Compound Name | N-(3-methylphenyl)-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide |
|---|---|
| PubChem CID | 90348625 |
| Molecular Formula | C31H35NO |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | N-(3-methylphenyl)-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide |
| SMILES | C=C(c1ccc(C(=O)Nc2cccc(C)c2)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C31H35NO/c1-20-9-8-10-25(17-20)32-29(33)24-13-11-23(12-14-24)22(3)26-19-28-27(18-21(26)2)30(4,5)15-16-31(28,6)7/h8-14,17-19H,3,15-16H2,1-2,4-7H3,(H,32,33) |
| InChIKey | ZMJMNCVNUXNVJA-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |