C24H32O6S — CID 22908098
ethyl 4-sulfooxybenzoate;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene (PubChem CID 22908098) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is ethyl 4-sulfooxybenzoate;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene.
| Compound Name | ethyl 4-sulfooxybenzoate;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 22908098 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | ethyl 4-sulfooxybenzoate;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene |
| SMILES | CCOC(=O)c1ccc(OS(=O)(=O)O)cc1.Cc1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C15H22.C9H10O6S/c1-11-6-7-12-13(10-11)15(4,5)9-8-14(12,2)3;1-2-14-9(10)7-3-5-8(6-4-7)15-16(11,12)13/h6-7,10H,8-9H2,1-5H3;3-6H,2H2,1H3,(H,11,12,13) |
| InChIKey | PPJRWRQUOVESTN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|