C23H23O3Se- — CID 54705148
2-carboxy-5-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenolate (PubChem CID 54705148) has the molecular formula C23H23O3Se- and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-carboxy-5-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenolate.
| Compound Name | 2-carboxy-5-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenolate |
|---|---|
| PubChem CID | 54705148 |
| Molecular Formula | C23H23O3Se- |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-carboxy-5-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenolate |
| SMILES | CC1(C)CCC(C)(C)c2cc([Se]C#Cc3ccc(C(=O)O)c([O-])c3)ccc21 |
| InChI | InChI=1S/C23H24O3Se/c1-22(2)10-11-23(3,4)19-14-16(6-8-18(19)22)27-12-9-15-5-7-17(21(25)26)20(24)13-15/h5-8,13-14,24H,10-11H2,1-4H3,(H,25,26)/p-1 |
| InChIKey | ZEXOUZYXKPZYBP-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|