C47H50O6 — CID 159887668
2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;methyl 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoate (PubChem CID 159887668) has the molecular formula C47H50O6 and a molecular weight of 710.91 g/mol. Its IUPAC name is 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;methyl 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoate.
| Compound Name | 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;methyl 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 159887668 |
| Molecular Formula | C47H50O6 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;methyl 2-hydroxy-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoate |
| SMILES | CC1(C)CCC(C)(C)c2cc(C#Cc3ccc(C(=O)O)c(O)c3)ccc21.COC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1O |
| InChI | InChI=1S/C24H26O3.C23H24O3/c1-23(2)12-13-24(3,4)20-14-16(9-11-19(20)23)6-7-17-8-10-18(21(25)15-17)22(26)27-5;1-22(2)11-12-23(3,4)19-13-15(8-10-18(19)22)5-6-16-7-9-17(21(25)26)20(24)14-16/h8-11,14-15,25H,12-13H2,1-5H3;7-10,13-14,24H,11-12H2,1-4H3,(H,25,26) |
| InChIKey | NUIMWOCWPHPRDG-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|