C25H27NO3 — CID 138489974
2-acetyl-3-amino-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid (PubChem CID 138489974) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-acetyl-3-amino-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid.
| Compound Name | 2-acetyl-3-amino-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 138489974 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-acetyl-3-amino-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid |
| SMILES | CC(=O)c1c(C(=O)O)ccc(C#Cc2ccc3c(c2)C(C)(C)CCC3(C)C)c1N |
| InChI | InChI=1S/C25H27NO3/c1-15(27)21-18(23(28)29)10-9-17(22(21)26)8-6-16-7-11-19-20(14-16)25(4,5)13-12-24(19,2)3/h7,9-11,14H,12-13,26H2,1-5H3,(H,28,29) |
| InChIKey | VCPDFGPPLHWCND-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|