C28H32O4 — CID 139804116
2-tert-butyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyloxy]benzoic acid (PubChem CID 139804116) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyloxy]benzoic acid.
| Compound Name | 2-tert-butyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyloxy]benzoic acid |
|---|---|
| PubChem CID | 139804116 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-tert-butyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyloxy]benzoic acid |
| SMILES | CC(C)(C)c1cc(OC(=O)C#Cc2ccc3c(c2)C(C)(C)CCC3(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C28H32O4/c1-26(2,3)22-17-19(10-11-20(22)25(30)31)32-24(29)13-9-18-8-12-21-23(16-18)28(6,7)15-14-27(21,4)5/h8,10-12,16-17H,14-15H2,1-7H3,(H,30,31) |
| InChIKey | QXPXJEHYGPVFKV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|