C25H26O2 — CID 19786981
(E)-3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]phenyl]prop-2-enoic acid (PubChem CID 19786981) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is (E)-3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 19786981 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (E)-3-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C#Cc3ccc(/C=C/C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C25H26O2/c1-24(2)15-16-25(3,4)22-17-20(11-13-21(22)24)10-9-18-5-7-19(8-6-18)12-14-23(26)27/h5-8,11-14,17H,15-16H2,1-4H3,(H,26,27)/b14-12+ |
| InChIKey | QSFNLGOOGOSDLM-WYMLVPIESA-N |
| XLogP | 5.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|