C24H28O3S — CID 14327182
(E)-3-(4-methylsulfonylphenyl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one (PubChem CID 14327182) has the molecular formula C24H28O3S and a molecular weight of 396.55 g/mol. Its IUPAC name is (E)-3-(4-methylsulfonylphenyl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-methylsulfonylphenyl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 14327182 |
| Molecular Formula | C24H28O3S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (E)-3-(4-methylsulfonylphenyl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)/C=C/c3ccc(S(C)(=O)=O)cc3)ccc21 |
| InChI | InChI=1S/C24H28O3S/c1-23(2)14-15-24(3,4)21-16-18(9-12-20(21)23)22(25)13-8-17-6-10-19(11-7-17)28(5,26)27/h6-13,16H,14-15H2,1-5H3/b13-8+ |
| InChIKey | ZLYLPLOVVVEREZ-MDWZMJQESA-N |
| XLogP | 5.34 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|