C50H67N3O3 — CID 123674140
N-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethyl]-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide (PubChem CID 123674140) has the molecular formula C50H67N3O3 and a molecular weight of 758.10 g/mol. Its IUPAC name is N-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethyl]-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide.
| Compound Name | N-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethyl]-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 123674140 |
| Molecular Formula | C50H67N3O3 |
| Molecular Weight | 758.10 g/mol |
| Exact Mass | 757.52 |
| IUPAC Name | N-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylamino]ethyl]-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNCCNC(=O)c1ccc(C=CC(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C50H67N3O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-47(55)52-38-36-51-37-39-53-48(56)42-29-26-41(27-30-42)28-33-46(54)43-31-32-44-45(40-43)50(4,5)35-34-49(44,2)3/h7-8,10-11,13-14,16-17,19-20,22-23,26-33,40,51H,6,9,12,15,18,21,24-25,34-39H2,1-5H3,(H,52,55)(H,53,56) |
| InChIKey | UHKFIRKFMDZKCM-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.10 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|