C25H31NO3S — CID 67935172
N-ethyl-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzenesulfonamide (PubChem CID 67935172) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is N-ethyl-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzenesulfonamide.
| Compound Name | N-ethyl-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67935172 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-ethyl-4-[3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(C=CC(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C25H31NO3S/c1-6-26-30(28,29)20-11-7-18(8-12-20)9-14-23(27)19-10-13-21-22(17-19)25(4,5)16-15-24(21,2)3/h7-14,17,26H,6,15-16H2,1-5H3 |
| InChIKey | HLNFYYRHCNRUJH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|