C34H46N2O2S2 — CID 89159238
N-[2-[5-[(3R)-dithiolan-3-yl]pentylamino]ethyl]-4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide (PubChem CID 89159238) has the molecular formula C34H46N2O2S2 and a molecular weight of 578.89 g/mol. Its IUPAC name is N-[2-[5-[(3R)-dithiolan-3-yl]pentylamino]ethyl]-4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide.
| Compound Name | N-[2-[5-[(3R)-dithiolan-3-yl]pentylamino]ethyl]-4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 89159238 |
| Molecular Formula | C34H46N2O2S2 |
| Molecular Weight | 578.89 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | N-[2-[5-[(3R)-dithiolan-3-yl]pentylamino]ethyl]-4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)/C=C/c3ccc(C(=O)NCCNCCCCC[C@@H]4CCSS4)cc3)ccc21 |
| InChI | InChI=1S/C34H46N2O2S2/c1-33(2)18-19-34(3,4)30-24-27(14-15-29(30)33)31(37)16-11-25-9-12-26(13-10-25)32(38)36-22-21-35-20-7-5-6-8-28-17-23-39-40-28/h9-16,24,28,35H,5-8,17-23H2,1-4H3,(H,36,38)/b16-11+/t28-/m1/s1 |
| InChIKey | NCMSSGZRZQUCGX-FEBJRPPSSA-N |
| XLogP | 7.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.89 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|