C49H68N2O3 — CID 89159119
2-[[(5Z,8Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]-6-[4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]anilino]hexanoic acid (PubChem CID 89159119) has the molecular formula C49H68N2O3 and a molecular weight of 733.09 g/mol. Its IUPAC name is 2-[[(5Z,8Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]-6-[4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]anilino]hexanoic acid.
| Compound Name | 2-[[(5Z,8Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]-6-[4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]anilino]hexanoic acid |
|---|---|
| PubChem CID | 89159119 |
| Molecular Formula | C49H68N2O3 |
| Molecular Weight | 733.09 g/mol |
| Exact Mass | 732.52 |
| IUPAC Name | 2-[[(5Z,8Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]-6-[4-[(E)-3-oxo-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]anilino]hexanoic acid |
| SMILES | CC/C=C\CC=CCC=CC/C=C\C/C=C\CCCCNC(CCCCNc1ccc(/C=C/C(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C49H68N2O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-38-51-45(47(53)54)26-23-25-37-50-42-31-27-40(28-32-42)29-34-46(52)41-30-33-43-44(39-41)49(4,5)36-35-48(43,2)3/h7-8,10-11,13-14,16-17,19-20,27-34,39,45,50-51H,6,9,12,15,18,21-26,35-38H2,1-5H3,(H,53,54)/b8-7-,11-10?,14-13?,17-16-,20-19-,34-29+ |
| InChIKey | IHKGGEBQHZLAIK-BRHADBDQSA-N |
| XLogP | 12.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.09 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|