C25H28O3 — CID 121474344
methyl (E)-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]prop-2-enoate (PubChem CID 121474344) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl (E)-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 121474344 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl (E)-3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C25H28O3/c1-24(2)14-15-25(3,4)21-16-19(11-12-20(21)24)23(27)18-9-6-17(7-10-18)8-13-22(26)28-5/h6-13,16H,14-15H2,1-5H3/b13-8+ |
| InChIKey | VFDCLAQCHYOKPF-MDWZMJQESA-N |
| XLogP | 5.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|