C26H33NO — CID 52949906
(E)-3-[4-(dimethylamino)phenyl]-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one (PubChem CID 52949906) has the molecular formula C26H33NO and a molecular weight of 375.56 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52949906 |
| Molecular Formula | C26H33NO |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
| SMILES | Cc1cc2c(cc1C(=O)/C=C/c1ccc(N(C)C)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H33NO/c1-18-16-22-23(26(4,5)15-14-25(22,2)3)17-21(18)24(28)13-10-19-8-11-20(12-9-19)27(6)7/h8-13,16-17H,14-15H2,1-7H3/b13-10+ |
| InChIKey | OBGMYSNLDMVQKW-JLHYYAGUSA-N |
| XLogP | 6.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|