C26H30O2 — CID 21185962
(E)-3-[3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 21185962) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is (E)-3-[3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 21185962 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (E)-3-[3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | C=C(c1cccc(/C=C/C(=O)O)c1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30O2/c1-17-14-22-23(26(5,6)13-12-25(22,3)4)16-21(17)18(2)20-9-7-8-19(15-20)10-11-24(27)28/h7-11,14-16H,2,12-13H2,1,3-6H3,(H,27,28)/b11-10+ |
| InChIKey | YKRLCFBEYDTXIO-ZHACJKMWSA-N |
| XLogP | 6.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|