C27H32O3 — CID 70183794
3-[4-hydroxy-3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoic acid (PubChem CID 70183794) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is 3-[4-hydroxy-3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-hydroxy-3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70183794 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 3-[4-hydroxy-3-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc2c(cc1C1(c3cc(C=CC(=O)O)ccc3O)CC1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H32O3/c1-17-14-20-21(26(4,5)11-10-25(20,2)3)16-19(17)27(12-13-27)22-15-18(6-8-23(22)28)7-9-24(29)30/h6-9,14-16,28H,10-13H2,1-5H3,(H,29,30) |
| InChIKey | UPHWGTXEBBJVLD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|