C24H26O3 — CID 71503444
(E)-3-[4-hydroxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]prop-2-enoic acid (PubChem CID 71503444) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is (E)-3-[4-hydroxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-hydroxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71503444 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (E)-3-[4-hydroxy-3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc2c(cc1-c1cc(/C=C/C(=O)O)ccc1O)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C24H26O3/c1-15-12-19-20(24(4,5)11-10-23(19,2)3)14-17(15)18-13-16(6-8-21(18)25)7-9-22(26)27/h6-14,25H,1-5H3,(H,26,27)/b9-7+ |
| InChIKey | KEKDDMHLCXISDJ-VQHVLOKHSA-N |
| XLogP | 5.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|