C33H42N2O3 — CID 21047946
N-[[4-(dimethylamino)phenyl]methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-propan-2-ylfuran-2-carboxamide (PubChem CID 21047946) has the molecular formula C33H42N2O3 and a molecular weight of 514.71 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 21047946 |
| Molecular Formula | C33H42N2O3 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-propan-2-ylfuran-2-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C(=O)N(Cc3ccc(N(C)C)cc3)C(C)C)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H42N2O3/c1-21(2)35(20-23-10-12-24(13-11-23)34(8)9)31(37)29-15-14-28(38-29)30(36)25-19-27-26(18-22(25)3)32(4,5)16-17-33(27,6)7/h10-15,18-19,21H,16-17,20H2,1-9H3 |
| InChIKey | NTEQWPLCIVHXBT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|