C33H39NO5 — CID 21046712
N-[1-(3,4-dimethoxyphenyl)but-3-enyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide (PubChem CID 21046712) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)but-3-enyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)but-3-enyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21046712 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)but-3-enyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide |
| SMILES | C=CCC(NC(=O)c1ccc(C(=O)c2cc3c(cc2C)C(C)(C)CCC3(C)C)o1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H39NO5/c1-9-10-25(21-11-12-26(37-7)29(18-21)38-8)34-31(36)28-14-13-27(39-28)30(35)22-19-24-23(17-20(22)2)32(3,4)15-16-33(24,5)6/h9,11-14,17-19,25H,1,10,15-16H2,2-8H3,(H,34,36) |
| InChIKey | BRZLFGUPOYPQTC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|