C27H31NO4 — CID 21048143
N-[(5-methylfuran-2-yl)methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide (PubChem CID 21048143) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide.
| Compound Name | N-[(5-methylfuran-2-yl)methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21048143 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methyl]-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(C(=O)c3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)o1 |
| InChI | InChI=1S/C27H31NO4/c1-16-13-20-21(27(5,6)12-11-26(20,3)4)14-19(16)24(29)22-9-10-23(32-22)25(30)28-15-18-8-7-17(2)31-18/h7-10,13-14H,11-12,15H2,1-6H3,(H,28,30) |
| InChIKey | FTHDYTAAJYCHOW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |