C32H33NO3 — CID 21046851
N-(naphthalen-1-ylmethyl)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide (PubChem CID 21046851) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethyl)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide.
| Compound Name | N-(naphthalen-1-ylmethyl)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21046851 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-(naphthalen-1-ylmethyl)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C(=O)NCc3cccc4ccccc34)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H33NO3/c1-20-17-25-26(32(4,5)16-15-31(25,2)3)18-24(20)29(34)27-13-14-28(36-27)30(35)33-19-22-11-8-10-21-9-6-7-12-23(21)22/h6-14,17-18H,15-16,19H2,1-5H3,(H,33,35) |
| InChIKey | YABDVANNHLWLKG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |