C29H33NO4 — CID 21045708
5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(2-phenoxyethyl)furan-2-carboxamide (PubChem CID 21045708) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(2-phenoxyethyl)furan-2-carboxamide.
| Compound Name | 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(2-phenoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21045708 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(2-phenoxyethyl)furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C(=O)NCCOc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H33NO4/c1-19-17-22-23(29(4,5)14-13-28(22,2)3)18-21(19)26(31)24-11-12-25(34-24)27(32)30-15-16-33-20-9-7-6-8-10-20/h6-12,17-18H,13-16H2,1-5H3,(H,30,32) |
| InChIKey | YQVMSAUXUMSRSV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|