C34H22O8 — CID 90366804
(E)-3-[3-[2-[4-[2-[3,5-bis[(E)-2-carboxyethenyl]phenyl]ethynyl]phenyl]ethynyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid (PubChem CID 90366804) has the molecular formula C34H22O8 and a molecular weight of 558.54 g/mol. Its IUPAC name is (E)-3-[3-[2-[4-[2-[3,5-bis[(E)-2-carboxyethenyl]phenyl]ethynyl]phenyl]ethynyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-[4-[2-[3,5-bis[(E)-2-carboxyethenyl]phenyl]ethynyl]phenyl]ethynyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90366804 |
| Molecular Formula | C34H22O8 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | (E)-3-[3-[2-[4-[2-[3,5-bis[(E)-2-carboxyethenyl]phenyl]ethynyl]phenyl]ethynyl]-5-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(C#Cc2ccc(C#Cc3cc(/C=C/C(=O)O)cc(/C=C/C(=O)O)c3)cc2)cc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C34H22O8/c35-31(36)13-9-27-17-25(18-28(21-27)10-14-32(37)38)7-5-23-1-2-24(4-3-23)6-8-26-19-29(11-15-33(39)40)22-30(20-26)12-16-34(41)42/h1-4,9-22H,(H,35,36)(H,37,38)(H,39,40)(H,41,42)/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | XZQRFHWTITXTLW-KUWVSJDVSA-N |
| XLogP | 4.88 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|