C24H26O2 — CID 178096887
3-methyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid (PubChem CID 178096887) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-methyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid.
| Compound Name | 3-methyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 178096887 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-methyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1C#Cc1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H26O2/c1-16-14-19(22(25)26)10-9-18(16)8-6-17-7-11-20-21(15-17)24(4,5)13-12-23(20,2)3/h7,9-11,14-15H,12-13H2,1-5H3,(H,25,26) |
| InChIKey | OQZPPEAQJQNMNW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|