C22H28O2Se — CID 22969559
(E)-3-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]hex-2-enoic acid (PubChem CID 22969559) has the molecular formula C22H28O2Se and a molecular weight of 403.42 g/mol. Its IUPAC name is (E)-3-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]hex-2-enoic acid.
| Compound Name | (E)-3-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 22969559 |
| Molecular Formula | C22H28O2Se |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (E)-3-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]hex-2-enoic acid |
| SMILES | CCC/C(C#C[Se]c1ccc2c(c1)C(C)(C)CCC2(C)C)=C\C(=O)O |
| InChI | InChI=1S/C22H28O2Se/c1-6-7-16(14-20(23)24)10-13-25-17-8-9-18-19(15-17)22(4,5)12-11-21(18,2)3/h8-9,14-15H,6-7,11-12H2,1-5H3,(H,23,24)/b16-14+ |
| InChIKey | VKMFDKQTZLGCGX-JQIJEIRASA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|