C31H31ClO3Se — CID 86599538
methyl 4-[2-[[4-[(4-chlorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate (PubChem CID 86599538) has the molecular formula C31H31ClO3Se and a molecular weight of 566.00 g/mol. Its IUPAC name is methyl 4-[2-[[4-[(4-chlorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[[4-[(4-chlorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 86599538 |
| Molecular Formula | C31H31ClO3Se |
| Molecular Weight | 566.00 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | methyl 4-[2-[[4-[(4-chlorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#C[Se]c2cc(OCc3ccc(Cl)cc3)c3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C31H31ClO3Se/c1-30(2)15-16-31(3,4)28-26(30)18-25(19-27(28)35-20-22-8-12-24(32)13-9-22)36-17-14-21-6-10-23(11-7-21)29(33)34-5/h6-13,18-19H,15-16,20H2,1-5H3 |
| InChIKey | BKQBPRHAKNOTTN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.00 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|